C21H22F2N4O2S — CID 139375874
(2S)-5-(2,5-difluorophenyl)-N-methoxy-N-methyl-2-[3-(methylideneamino)propyl]-2-phenyl-1,3,4-thiadiazole-3-carboxamide (PubChem CID 139375874) has the molecular formula C21H22F2N4O2S and a molecular weight of 432.50 g/mol. Its IUPAC name is (2S)-5-(2,5-difluorophenyl)-N-methoxy-N-methyl-2-[3-(methylideneamino)propyl]-2-phenyl-1,3,4-thiadiazole-3-carboxamide.
| Compound Name | (2S)-5-(2,5-difluorophenyl)-N-methoxy-N-methyl-2-[3-(methylideneamino)propyl]-2-phenyl-1,3,4-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 139375874 |
| Molecular Formula | C21H22F2N4O2S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | (2S)-5-(2,5-difluorophenyl)-N-methoxy-N-methyl-2-[3-(methylideneamino)propyl]-2-phenyl-1,3,4-thiadiazole-3-carboxamide |
| SMILES | C=NCCC[C@@]1(c2ccccc2)SC(c2cc(F)ccc2F)=NN1C(=O)N(C)OC |
| InChI | InChI=1S/C21H22F2N4O2S/c1-24-13-7-12-21(15-8-5-4-6-9-15)27(20(28)26(2)29-3)25-19(30-21)17-14-16(22)10-11-18(17)23/h4-6,8-11,14H,1,7,12-13H2,2-3H3/t21-/m0/s1 |
| InChIKey | ZHLLLOKXLXVQJE-NRFANRHFSA-N |
| XLogP | 4.62 |
| TPSA | 57.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|