C21H23F2N3O3S — CID 87391683
5-(2,5-difluorophenyl)-N-hydroxy-2-(3-hydroxypropyl)-2-phenyl-N-propan-2-yl-1,3,4-thiadiazole-3-carboxamide (PubChem CID 87391683) has the molecular formula C21H23F2N3O3S and a molecular weight of 435.50 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)-N-hydroxy-2-(3-hydroxypropyl)-2-phenyl-N-propan-2-yl-1,3,4-thiadiazole-3-carboxamide.
| Compound Name | 5-(2,5-difluorophenyl)-N-hydroxy-2-(3-hydroxypropyl)-2-phenyl-N-propan-2-yl-1,3,4-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 87391683 |
| Molecular Formula | C21H23F2N3O3S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 5-(2,5-difluorophenyl)-N-hydroxy-2-(3-hydroxypropyl)-2-phenyl-N-propan-2-yl-1,3,4-thiadiazole-3-carboxamide |
| SMILES | CC(C)N(O)C(=O)N1N=C(c2cc(F)ccc2F)SC1(CCCO)c1ccccc1 |
| InChI | InChI=1S/C21H23F2N3O3S/c1-14(2)25(29)20(28)26-21(11-6-12-27,15-7-4-3-5-8-15)30-19(24-26)17-13-16(22)9-10-18(17)23/h3-5,7-10,13-14,27,29H,6,11-12H2,1-2H3 |
| InChIKey | NGQIIGGOBXADIS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|