C22H23F2N3O3S — CID 87713682
N-(cyclopropylmethoxy)-5-(2,5-difluorophenyl)-2-(3-hydroxypropyl)-2-phenyl-1,3,4-thiadiazole-3-carboxamide (PubChem CID 87713682) has the molecular formula C22H23F2N3O3S and a molecular weight of 447.51 g/mol. Its IUPAC name is N-(cyclopropylmethoxy)-5-(2,5-difluorophenyl)-2-(3-hydroxypropyl)-2-phenyl-1,3,4-thiadiazole-3-carboxamide.
| Compound Name | N-(cyclopropylmethoxy)-5-(2,5-difluorophenyl)-2-(3-hydroxypropyl)-2-phenyl-1,3,4-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 87713682 |
| Molecular Formula | C22H23F2N3O3S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | N-(cyclopropylmethoxy)-5-(2,5-difluorophenyl)-2-(3-hydroxypropyl)-2-phenyl-1,3,4-thiadiazole-3-carboxamide |
| SMILES | O=C(NOCC1CC1)N1N=C(c2cc(F)ccc2F)SC1(CCCO)c1ccccc1 |
| InChI | InChI=1S/C22H23F2N3O3S/c23-17-9-10-19(24)18(13-17)20-25-27(21(29)26-30-14-15-7-8-15)22(31-20,11-4-12-28)16-5-2-1-3-6-16/h1-3,5-6,9-10,13,15,28H,4,7-8,11-12,14H2,(H,26,29) |
| InChIKey | AYMVMYRAOMIOSG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|