C22H24F2N3O6PS — CID 87713661
3-[3-(cyclopropylmethoxycarbamoyl)-5-(2,5-difluorophenyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl dihydrogen phosphate (PubChem CID 87713661) has the molecular formula C22H24F2N3O6PS and a molecular weight of 527.49 g/mol. Its IUPAC name is 3-[3-(cyclopropylmethoxycarbamoyl)-5-(2,5-difluorophenyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl dihydrogen phosphate.
| Compound Name | 3-[3-(cyclopropylmethoxycarbamoyl)-5-(2,5-difluorophenyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl dihydrogen phosphate |
|---|---|
| PubChem CID | 87713661 |
| Molecular Formula | C22H24F2N3O6PS |
| Molecular Weight | 527.49 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | 3-[3-(cyclopropylmethoxycarbamoyl)-5-(2,5-difluorophenyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl dihydrogen phosphate |
| SMILES | O=C(NOCC1CC1)N1N=C(c2cc(F)ccc2F)SC1(CCCOP(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C22H24F2N3O6PS/c23-17-9-10-19(24)18(13-17)20-25-27(21(28)26-32-14-15-7-8-15)22(35-20,16-5-2-1-3-6-16)11-4-12-33-34(29,30)31/h1-3,5-6,9-10,13,15H,4,7-8,11-12,14H2,(H,26,28)(H2,29,30,31) |
| InChIKey | ZATQPFUQJIUCIX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 120.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|