C21H24F2N3O6PS — CID 87390898
3-[5-(2,5-difluorophenyl)-3-[ethoxy(methyl)carbamoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]propyl dihydrogen phosphate (PubChem CID 87390898) has the molecular formula C21H24F2N3O6PS and a molecular weight of 515.48 g/mol. Its IUPAC name is 3-[5-(2,5-difluorophenyl)-3-[ethoxy(methyl)carbamoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]propyl dihydrogen phosphate.
| Compound Name | 3-[5-(2,5-difluorophenyl)-3-[ethoxy(methyl)carbamoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]propyl dihydrogen phosphate |
|---|---|
| PubChem CID | 87390898 |
| Molecular Formula | C21H24F2N3O6PS |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | 3-[5-(2,5-difluorophenyl)-3-[ethoxy(methyl)carbamoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]propyl dihydrogen phosphate |
| SMILES | CCON(C)C(=O)N1N=C(c2cc(F)ccc2F)SC1(CCCOP(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C21H24F2N3O6PS/c1-3-31-25(2)20(27)26-21(15-8-5-4-6-9-15,12-7-13-32-33(28,29)30)34-19(24-26)17-14-16(22)10-11-18(17)23/h4-6,8-11,14H,3,7,12-13H2,1-2H3,(H2,28,29,30) |
| InChIKey | LMAYHPYCHAPCHL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|