C19H20F2N3O6PS — CID 87391331
2-[5-(2,5-difluorophenyl)-3-[methoxy(methyl)carbamoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]ethyl dihydrogen phosphate (PubChem CID 87391331) has the molecular formula C19H20F2N3O6PS and a molecular weight of 487.42 g/mol. Its IUPAC name is 2-[5-(2,5-difluorophenyl)-3-[methoxy(methyl)carbamoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]ethyl dihydrogen phosphate.
| Compound Name | 2-[5-(2,5-difluorophenyl)-3-[methoxy(methyl)carbamoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 87391331 |
| Molecular Formula | C19H20F2N3O6PS |
| Molecular Weight | 487.42 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | 2-[5-(2,5-difluorophenyl)-3-[methoxy(methyl)carbamoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]ethyl dihydrogen phosphate |
| SMILES | CON(C)C(=O)N1N=C(c2cc(F)ccc2F)SC1(CCOP(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C19H20F2N3O6PS/c1-23(29-2)18(25)24-19(10-11-30-31(26,27)28,13-6-4-3-5-7-13)32-17(22-24)15-12-14(20)8-9-16(15)21/h3-9,12H,10-11H2,1-2H3,(H2,26,27,28) |
| InChIKey | OXYYENIDQIYEFM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|