C21H25FN4O2S — CID 131972134
(2S)-2-(3-aminopropyl)-5-(2-fluoro-5-methylphenyl)-N-methoxy-N-methyl-2-phenyl-1,3,4-thiadiazole-3-carboxamide (PubChem CID 131972134) has the molecular formula C21H25FN4O2S and a molecular weight of 416.52 g/mol. Its IUPAC name is (2S)-2-(3-aminopropyl)-5-(2-fluoro-5-methylphenyl)-N-methoxy-N-methyl-2-phenyl-1,3,4-thiadiazole-3-carboxamide.
| Compound Name | (2S)-2-(3-aminopropyl)-5-(2-fluoro-5-methylphenyl)-N-methoxy-N-methyl-2-phenyl-1,3,4-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 131972134 |
| Molecular Formula | C21H25FN4O2S |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (2S)-2-(3-aminopropyl)-5-(2-fluoro-5-methylphenyl)-N-methoxy-N-methyl-2-phenyl-1,3,4-thiadiazole-3-carboxamide |
| SMILES | CON(C)C(=O)N1N=C(c2cc(C)ccc2F)S[C@@]1(CCCN)c1ccccc1 |
| InChI | InChI=1S/C21H25FN4O2S/c1-15-10-11-18(22)17(14-15)19-24-26(20(27)25(2)28-3)21(29-19,12-7-13-23)16-8-5-4-6-9-16/h4-6,8-11,14H,7,12-13,23H2,1-3H3/t21-/m0/s1 |
| InChIKey | KCLUUOUCRHUUOL-NRFANRHFSA-N |
| XLogP | 4.05 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|