C23H27F2N5O2S — CID 59193001
2-[3-[5-(2,5-difluorophenyl)-3-(2-methylpropanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-1-methoxyguanidine (PubChem CID 59193001) has the molecular formula C23H27F2N5O2S and a molecular weight of 475.57 g/mol. Its IUPAC name is 2-[3-[5-(2,5-difluorophenyl)-3-(2-methylpropanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-1-methoxyguanidine.
| Compound Name | 2-[3-[5-(2,5-difluorophenyl)-3-(2-methylpropanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-1-methoxyguanidine |
|---|---|
| PubChem CID | 59193001 |
| Molecular Formula | C23H27F2N5O2S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 2-[3-[5-(2,5-difluorophenyl)-3-(2-methylpropanoyl)-2-phenyl-1,3,4-thiadiazol-2-yl]propyl]-1-methoxyguanidine |
| SMILES | CON/C(N)=N/CCCC1(c2ccccc2)SC(c2cc(F)ccc2F)=NN1C(=O)C(C)C |
| InChI | InChI=1S/C23H27F2N5O2S/c1-15(2)21(31)30-23(16-8-5-4-6-9-16,12-7-13-27-22(26)29-32-3)33-20(28-30)18-14-17(24)10-11-19(18)25/h4-6,8-11,14-15H,7,12-13H2,1-3H3,(H3,26,27,29) |
| InChIKey | JQRYPZKSXMCIFI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|