C14H14AlF2N5S2 — CID 147457228
CID 147457228 (PubChem CID 147457228) has the molecular formula C14H14AlF2N5S2 and a molecular weight of 381.41 g/mol.
| Compound Name | CID 147457228 |
|---|---|
| PubChem CID | 147457228 |
| Molecular Formula | C14H14AlF2N5S2 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | — |
| SMILES | Cc1nnc(N2N=C(c3cc(F)ccc3F)SC2([Al])CCCN)s1 |
| InChI | InChI=1S/C14H14F2N5S2.Al/c1-8-18-19-14(22-8)21-12(3-2-6-17)23-13(20-21)10-7-9(15)4-5-11(10)16;/h4-5,7H,2-3,6,17H2,1H3; |
| InChIKey | CQAIPDKONUDPPB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 67.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |