C18H18F2N6S3 — CID 90269230
3-[2-[5-(2,5-difluorophenyl)-2-methyl-1,3-thiazol-4-yl]-3-(5-methyl-1,3,4-thiadiazol-2-yl)-1,3,4-thiadiazol-2-yl]propan-1-amine (PubChem CID 90269230) has the molecular formula C18H18F2N6S3 and a molecular weight of 452.58 g/mol. Its IUPAC name is 3-[2-[5-(2,5-difluorophenyl)-2-methyl-1,3-thiazol-4-yl]-3-(5-methyl-1,3,4-thiadiazol-2-yl)-1,3,4-thiadiazol-2-yl]propan-1-amine.
| Compound Name | 3-[2-[5-(2,5-difluorophenyl)-2-methyl-1,3-thiazol-4-yl]-3-(5-methyl-1,3,4-thiadiazol-2-yl)-1,3,4-thiadiazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 90269230 |
| Molecular Formula | C18H18F2N6S3 |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 3-[2-[5-(2,5-difluorophenyl)-2-methyl-1,3-thiazol-4-yl]-3-(5-methyl-1,3,4-thiadiazol-2-yl)-1,3,4-thiadiazol-2-yl]propan-1-amine |
| SMILES | Cc1nnc(N2N=CSC2(CCCN)c2nc(C)sc2-c2cc(F)ccc2F)s1 |
| InChI | InChI=1S/C18H18F2N6S3/c1-10-23-16(15(28-10)13-8-12(19)4-5-14(13)20)18(6-3-7-21)26(22-9-27-18)17-25-24-11(2)29-17/h4-5,8-9H,3,6-7,21H2,1-2H3 |
| InChIKey | OTDHNWLFERFWSB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |