C22H22F2N6OS2 — CID 91303689
4-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]-N'-methoxybutanimidamide (PubChem CID 91303689) has the molecular formula C22H22F2N6OS2 and a molecular weight of 488.59 g/mol. Its IUPAC name is 4-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]-N'-methoxybutanimidamide.
| Compound Name | 4-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]-N'-methoxybutanimidamide |
|---|---|
| PubChem CID | 91303689 |
| Molecular Formula | C22H22F2N6OS2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 4-[5-(2,5-difluorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenyl-1,3,4-thiadiazol-2-yl]-N'-methoxybutanimidamide |
| SMILES | CON=C(N)CCCC1(c2ccccc2)SC(c2cc(F)ccc2F)=NN1c1nnc(C)s1 |
| InChI | InChI=1S/C22H22F2N6OS2/c1-14-26-27-21(32-14)30-22(15-7-4-3-5-8-15,12-6-9-19(25)29-31-2)33-20(28-30)17-13-16(23)10-11-18(17)24/h3-5,7-8,10-11,13H,6,9,12H2,1-2H3,(H2,25,29) |
| InChIKey | ACYGDGAGZRKSPS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|