C20H20F2N6O3S — CID 173092280
[N-[5-(2,5-difluorophenyl)-3-[(2S)-2-hydroxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]-N-methylcarbamimidoyl]urea (PubChem CID 173092280) has the molecular formula C20H20F2N6O3S and a molecular weight of 462.48 g/mol. Its IUPAC name is [N-[5-(2,5-difluorophenyl)-3-[(2S)-2-hydroxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]-N-methylcarbamimidoyl]urea.
| Compound Name | [N-[5-(2,5-difluorophenyl)-3-[(2S)-2-hydroxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]-N-methylcarbamimidoyl]urea |
|---|---|
| PubChem CID | 173092280 |
| Molecular Formula | C20H20F2N6O3S |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | [N-[5-(2,5-difluorophenyl)-3-[(2S)-2-hydroxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]-N-methylcarbamimidoyl]urea |
| SMILES | [H]/N=C(\NC(N)=O)N(C)C1(c2ccccc2)SC(c2cc(F)ccc2F)=NN1C(=O)[C@H](C)O |
| InChI | InChI=1S/C20H20F2N6O3S/c1-11(29)17(30)28-20(12-6-4-3-5-7-12,27(2)18(23)25-19(24)31)32-16(26-28)14-10-13(21)8-9-15(14)22/h3-11,29H,1-2H3,(H4,23,24,25,31)/t11-,20?/m0/s1 |
| InChIKey | VZAKLUPRYVSXCQ-ZOZMEPSFSA-N |
| XLogP | 1.93 |
| TPSA | 135.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|