C24H28F2N4O4S — CID 68976784
2-[5-(2,5-difluorophenyl)-3-[(2S)-2-methoxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]-2,2-diethoxyethanimidamide (PubChem CID 68976784) has the molecular formula C24H28F2N4O4S and a molecular weight of 506.58 g/mol. Its IUPAC name is 2-[5-(2,5-difluorophenyl)-3-[(2S)-2-methoxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]-2,2-diethoxyethanimidamide.
| Compound Name | 2-[5-(2,5-difluorophenyl)-3-[(2S)-2-methoxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]-2,2-diethoxyethanimidamide |
|---|---|
| PubChem CID | 68976784 |
| Molecular Formula | C24H28F2N4O4S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 2-[5-(2,5-difluorophenyl)-3-[(2S)-2-methoxypropanoyl]-2-phenyl-1,3,4-thiadiazol-2-yl]-2,2-diethoxyethanimidamide |
| SMILES | [H]/N=C(\N)C(OCC)(OCC)C1(c2ccccc2)SC(c2cc(F)ccc2F)=NN1C(=O)[C@H](C)OC |
| InChI | InChI=1S/C24H28F2N4O4S/c1-5-33-24(22(27)28,34-6-2)23(16-10-8-7-9-11-16)30(21(31)15(3)32-4)29-20(35-23)18-14-17(25)12-13-19(18)26/h7-15H,5-6H2,1-4H3,(H3,27,28)/t15-,23?/m0/s1 |
| InChIKey | MCFBOKDDNXFLCA-NGMICRHFSA-N |
| XLogP | 3.79 |
| TPSA | 110.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|