C19H19N5O5S — CID 68503750
3-methyl-2-[[7-(2H-tetrazol-5-yl)dibenzofuran-3-yl]sulfonylamino]pentanoic acid (PubChem CID 68503750) has the molecular formula C19H19N5O5S and a molecular weight of 429.46 g/mol. Its IUPAC name is 3-methyl-2-[[7-(2H-tetrazol-5-yl)dibenzofuran-3-yl]sulfonylamino]pentanoic acid.
| Compound Name | 3-methyl-2-[[7-(2H-tetrazol-5-yl)dibenzofuran-3-yl]sulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 68503750 |
| Molecular Formula | C19H19N5O5S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 3-methyl-2-[[7-(2H-tetrazol-5-yl)dibenzofuran-3-yl]sulfonylamino]pentanoic acid |
| SMILES | CCC(C)C(NS(=O)(=O)c1ccc2c(c1)oc1cc(-c3nn[nH]n3)ccc12)C(=O)O |
| InChI | InChI=1S/C19H19N5O5S/c1-3-10(2)17(19(25)26)22-30(27,28)12-5-7-14-13-6-4-11(18-20-23-24-21-18)8-15(13)29-16(14)9-12/h4-10,17,22H,3H2,1-2H3,(H,25,26)(H,20,21,23,24) |
| InChIKey | JGLCGHQYSLMZQS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 151.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |