C12H17BO4 — CID 68505553
[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phenyl]boronic acid (PubChem CID 68505553) has the molecular formula C12H17BO4 and a molecular weight of 236.08 g/mol. Its IUPAC name is [3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phenyl]boronic acid.
| Compound Name | [3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 68505553 |
| Molecular Formula | C12H17BO4 |
| Molecular Weight | 236.08 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | [3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phenyl]boronic acid |
| SMILES | CC(C)(C)OC(=O)Cc1cccc(B(O)O)c1 |
| InChI | InChI=1S/C12H17BO4/c1-12(2,3)17-11(14)8-9-5-4-6-10(7-9)13(15)16/h4-7,15-16H,8H2,1-3H3 |
| InChIKey | BQONZISJAKJRKZ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.08 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|