C12H18BNO3 — CID 134128446
[3-[2-(tert-butylamino)-2-oxoethyl]phenyl]boronic acid (PubChem CID 134128446) has the molecular formula C12H18BNO3 and a molecular weight of 235.09 g/mol. Its IUPAC name is [3-[2-(tert-butylamino)-2-oxoethyl]phenyl]boronic acid.
| Compound Name | [3-[2-(tert-butylamino)-2-oxoethyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 134128446 |
| Molecular Formula | C12H18BNO3 |
| Molecular Weight | 235.09 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | [3-[2-(tert-butylamino)-2-oxoethyl]phenyl]boronic acid |
| SMILES | CC(C)(C)NC(=O)Cc1cccc(B(O)O)c1 |
| InChI | InChI=1S/C12H18BNO3/c1-12(2,3)14-11(15)8-9-5-4-6-10(7-9)13(16)17/h4-7,16-17H,8H2,1-3H3,(H,14,15) |
| InChIKey | IRLJIESLVKPESK-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.09 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|