C22H32O3 — CID 68505703
(5E,9E)-12-(3-methoxyphenyl)-5,6,9-trimethyldodeca-5,9-dienoic acid (PubChem CID 68505703) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (5E,9E)-12-(3-methoxyphenyl)-5,6,9-trimethyldodeca-5,9-dienoic acid.
| Compound Name | (5E,9E)-12-(3-methoxyphenyl)-5,6,9-trimethyldodeca-5,9-dienoic acid |
|---|---|
| PubChem CID | 68505703 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (5E,9E)-12-(3-methoxyphenyl)-5,6,9-trimethyldodeca-5,9-dienoic acid |
| SMILES | COc1cccc(CC/C=C(\C)CC/C(C)=C(\C)CCCC(=O)O)c1 |
| InChI | InChI=1S/C22H32O3/c1-17(8-5-10-20-11-7-12-21(16-20)25-4)14-15-19(3)18(2)9-6-13-22(23)24/h7-8,11-12,16H,5-6,9-10,13-15H2,1-4H3,(H,23,24)/b17-8+,19-18+ |
| InChIKey | WHAZXKPDLIYUMV-BTOTXDRHSA-N |
| XLogP | 5.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|