C20H24F3N3O3 — CID 68509081
3-oxo-2-[(1-propan-2-ylpyrazol-4-yl)methyl]-3-[N-propan-2-yl-3-(trifluoromethyl)anilino]propanoic acid (PubChem CID 68509081) has the molecular formula C20H24F3N3O3 and a molecular weight of 411.42 g/mol. Its IUPAC name is 3-oxo-2-[(1-propan-2-ylpyrazol-4-yl)methyl]-3-[N-propan-2-yl-3-(trifluoromethyl)anilino]propanoic acid.
| Compound Name | 3-oxo-2-[(1-propan-2-ylpyrazol-4-yl)methyl]-3-[N-propan-2-yl-3-(trifluoromethyl)anilino]propanoic acid |
|---|---|
| PubChem CID | 68509081 |
| Molecular Formula | C20H24F3N3O3 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 3-oxo-2-[(1-propan-2-ylpyrazol-4-yl)methyl]-3-[N-propan-2-yl-3-(trifluoromethyl)anilino]propanoic acid |
| SMILES | CC(C)N(C(=O)C(Cc1cnn(C(C)C)c1)C(=O)O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H24F3N3O3/c1-12(2)25-11-14(10-24-25)8-17(19(28)29)18(27)26(13(3)4)16-7-5-6-15(9-16)20(21,22)23/h5-7,9-13,17H,8H2,1-4H3,(H,28,29) |
| InChIKey | WRWWJMHKTGOQFK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|