C22H24N2O5 — CID 6851257
(2S)-2-[[(E)-2-benzamido-3-(3-propan-2-yloxyphenyl)prop-2-enoyl]amino]propanoic acid (PubChem CID 6851257) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is (2S)-2-[[(E)-2-benzamido-3-(3-propan-2-yloxyphenyl)prop-2-enoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(E)-2-benzamido-3-(3-propan-2-yloxyphenyl)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 6851257 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | (2S)-2-[[(E)-2-benzamido-3-(3-propan-2-yloxyphenyl)prop-2-enoyl]amino]propanoic acid |
| SMILES | CC(C)Oc1cccc(/C=C(/NC(=O)c2ccccc2)C(=O)N[C@@H](C)C(=O)O)c1 |
| InChI | InChI=1S/C22H24N2O5/c1-14(2)29-18-11-7-8-16(12-18)13-19(21(26)23-15(3)22(27)28)24-20(25)17-9-5-4-6-10-17/h4-15H,1-3H3,(H,23,26)(H,24,25)(H,27,28)/b19-13+/t15-/m0/s1 |
| InChIKey | GEJWWGWCXLOLAA-SJPXOZHESA-N |
| XLogP | 2.83 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|