C14H15NO7 — CID 68512960
5-[(3-methoxy-4-nitrophenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 68512960) has the molecular formula C14H15NO7 and a molecular weight of 309.27 g/mol. Its IUPAC name is 5-[(3-methoxy-4-nitrophenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(3-methoxy-4-nitrophenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 68512960 |
| Molecular Formula | C14H15NO7 |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 5-[(3-methoxy-4-nitrophenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | COc1cc(CC2C(=O)OC(C)(C)OC2=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15NO7/c1-14(2)21-12(16)9(13(17)22-14)6-8-4-5-10(15(18)19)11(7-8)20-3/h4-5,7,9H,6H2,1-3H3 |
| InChIKey | ZXXGSEBSPZZIBS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|