C17H22O6 — CID 11267232
5-[3-(3,4-dimethoxyphenyl)propyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 11267232) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is 5-[3-(3,4-dimethoxyphenyl)propyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[3-(3,4-dimethoxyphenyl)propyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 11267232 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 5-[3-(3,4-dimethoxyphenyl)propyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | COc1ccc(CCCC2C(=O)OC(C)(C)OC2=O)cc1OC |
| InChI | InChI=1S/C17H22O6/c1-17(2)22-15(18)12(16(19)23-17)7-5-6-11-8-9-13(20-3)14(10-11)21-4/h8-10,12H,5-7H2,1-4H3 |
| InChIKey | PQNHGBRAJMNLJY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|