C16H19N3O4 — CID 122053296
5-[3-(3,4-dimethoxyphenyl)propylamino]pyrazine-2-carboxylic acid (PubChem CID 122053296) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 5-[3-(3,4-dimethoxyphenyl)propylamino]pyrazine-2-carboxylic acid.
| Compound Name | 5-[3-(3,4-dimethoxyphenyl)propylamino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 122053296 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 5-[3-(3,4-dimethoxyphenyl)propylamino]pyrazine-2-carboxylic acid |
| SMILES | COc1ccc(CCCNc2cnc(C(=O)O)cn2)cc1OC |
| InChI | InChI=1S/C16H19N3O4/c1-22-13-6-5-11(8-14(13)23-2)4-3-7-17-15-10-18-12(9-19-15)16(20)21/h5-6,8-10H,3-4,7H2,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | HQAXEJGDWOAKPK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|