C21H18ClFN2O2 — CID 68513544
N-[1-(3-chlorophenyl)-2-hydroxyethyl]-4-(2-fluoro-5-methyl-4-pyridinyl)benzamide (PubChem CID 68513544) has the molecular formula C21H18ClFN2O2 and a molecular weight of 384.84 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)-2-hydroxyethyl]-4-(2-fluoro-5-methyl-4-pyridinyl)benzamide.
| Compound Name | N-[1-(3-chlorophenyl)-2-hydroxyethyl]-4-(2-fluoro-5-methyl-4-pyridinyl)benzamide |
|---|---|
| PubChem CID | 68513544 |
| Molecular Formula | C21H18ClFN2O2 |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N-[1-(3-chlorophenyl)-2-hydroxyethyl]-4-(2-fluoro-5-methyl-4-pyridinyl)benzamide |
| SMILES | Cc1cnc(F)cc1-c1ccc(C(=O)NC(CO)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C21H18ClFN2O2/c1-13-11-24-20(23)10-18(13)14-5-7-15(8-6-14)21(27)25-19(12-26)16-3-2-4-17(22)9-16/h2-11,19,26H,12H2,1H3,(H,25,27) |
| InChIKey | DUJALTQIUFFELN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|