C17H25FN2O2 — CID 68515222
(3S,4R)-4-(benzylamino)-2-tert-butyl-3-fluoropiperidine-1-carboxylic acid (PubChem CID 68515222) has the molecular formula C17H25FN2O2 and a molecular weight of 308.40 g/mol. Its IUPAC name is (3S,4R)-4-(benzylamino)-2-tert-butyl-3-fluoropiperidine-1-carboxylic acid.
| Compound Name | (3S,4R)-4-(benzylamino)-2-tert-butyl-3-fluoropiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68515222 |
| Molecular Formula | C17H25FN2O2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | (3S,4R)-4-(benzylamino)-2-tert-butyl-3-fluoropiperidine-1-carboxylic acid |
| SMILES | CC(C)(C)C1[C@@H](F)[C@H](NCc2ccccc2)CCN1C(=O)O |
| InChI | InChI=1S/C17H25FN2O2/c1-17(2,3)15-14(18)13(9-10-20(15)16(21)22)19-11-12-7-5-4-6-8-12/h4-8,13-15,19H,9-11H2,1-3H3,(H,21,22)/t13-,14+,15?/m1/s1 |
| InChIKey | DVBUYLXUBMACEP-GNXJLENFSA-N |
| XLogP | 3.28 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |