C25H24N4O3 — CID 68517635
benzyl N-[[4-[(4-methoxyphenyl)methylamino]quinazolin-2-yl]methyl]carbamate (PubChem CID 68517635) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is benzyl N-[[4-[(4-methoxyphenyl)methylamino]quinazolin-2-yl]methyl]carbamate.
| Compound Name | benzyl N-[[4-[(4-methoxyphenyl)methylamino]quinazolin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 68517635 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | benzyl N-[[4-[(4-methoxyphenyl)methylamino]quinazolin-2-yl]methyl]carbamate |
| SMILES | COc1ccc(CNc2nc(CNC(=O)OCc3ccccc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C25H24N4O3/c1-31-20-13-11-18(12-14-20)15-26-24-21-9-5-6-10-22(21)28-23(29-24)16-27-25(30)32-17-19-7-3-2-4-8-19/h2-14H,15-17H2,1H3,(H,27,30)(H,26,28,29) |
| InChIKey | HROHHXFQVOESKQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |