C17H15N7O — CID 68518029
N-[(4-methoxyphenyl)methyl]-2-(2H-tetrazol-5-yl)quinazolin-4-amine (PubChem CID 68518029) has the molecular formula C17H15N7O and a molecular weight of 333.36 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-2-(2H-tetrazol-5-yl)quinazolin-4-amine.
| Compound Name | N-[(4-methoxyphenyl)methyl]-2-(2H-tetrazol-5-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 68518029 |
| Molecular Formula | C17H15N7O |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-2-(2H-tetrazol-5-yl)quinazolin-4-amine |
| SMILES | COc1ccc(CNc2nc(-c3nn[nH]n3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C17H15N7O/c1-25-12-8-6-11(7-9-12)10-18-15-13-4-2-3-5-14(13)19-16(20-15)17-21-23-24-22-17/h2-9H,10H2,1H3,(H,18,19,20)(H,21,22,23,24) |
| InChIKey | IJLXQNGDEGPBNL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |