C23H29N3O5 — CID 68518853
2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-N-[(4-methoxyphenyl)methyl]quinazolin-4-amine (PubChem CID 68518853) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-N-[(4-methoxyphenyl)methyl]quinazolin-4-amine.
| Compound Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-N-[(4-methoxyphenyl)methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 68518853 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-N-[(4-methoxyphenyl)methyl]quinazolin-4-amine |
| SMILES | COCCOCCOCCOc1nc(NCc2ccc(OC)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C23H29N3O5/c1-27-11-12-29-13-14-30-15-16-31-23-25-21-6-4-3-5-20(21)22(26-23)24-17-18-7-9-19(28-2)10-8-18/h3-10H,11-17H2,1-2H3,(H,24,25,26) |
| InChIKey | MGXIZMXACMVGDX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|