carbamic acid;[4-(2-hydroxyethyl)piperidin-1-yl]methylidenecarbamic acid

C10H19N3O5 — CID 68518607

IUPACcarbamic acid;[4-(2-hydroxyethyl)piperidin-1-yl]methylidenecarbamic acid
SMILESNC(=O)O.O=C(O)N=CN1CCC(CCO)CC1
InChIInChI=1S/C9H16N2O3.CH3NO2/c12-6-3-8-1-4-11(5-2-8)7-10-9(13)14;2-1(3)4/h7-8,12H,1-6H2,(H,13,14);2H2,(H,3,4)
InChIKeyXRYAVFHJFLPYLD-UHFFFAOYSA-N
MW261.28 g/mol
LogP0.41
Rot. Bonds3

About carbamic acid;[4-(2-hydroxyethyl)piperidin-1-yl]methylidenecarbamic acid

carbamic acid;[4-(2-hydroxyethyl)piperidin-1-yl]methylidenecarbamic acid (PubChem CID 68518607) has the molecular formula C10H19N3O5 and a molecular weight of 261.28 g/mol. Its IUPAC name is carbamic acid;[4-(2-hydroxyethyl)piperidin-1-yl]methylidenecarbamic acid.

Molecular Properties

Compound Namecarbamic acid;[4-(2-hydroxyethyl)piperidin-1-yl]methylidenecarbamic acid
PubChem CID68518607
Molecular FormulaC10H19N3O5
Molecular Weight261.28 g/mol
Exact Mass261.13
IUPAC Namecarbamic acid;[4-(2-hydroxyethyl)piperidin-1-yl]methylidenecarbamic acid
SMILESNC(=O)O.O=C(O)N=CN1CCC(CCO)CC1
InChIInChI=1S/C9H16N2O3.CH3NO2/c12-6-3-8-1-4-11(5-2-8)7-10-9(13)14;2-1(3)4/h7-8,12H,1-6H2,(H,13,14);2H2,(H,3,4)
InChIKeyXRYAVFHJFLPYLD-UHFFFAOYSA-N
XLogP0.41
TPSA136.45 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.28
LogP ≤ 50.41
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}

Analyze carbamic acid;[4-(2-hydroxyethyl)piperidin-1-yl]methylidenecarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbamic acid;[4-(2-hydroxyethyl)piperidin-1-yl]methylidenecarbamic acid?
The IUPAC name of carbamic acid;[4-(2-hydroxyethyl)piperidin-1-yl]methylidenecarbamic acid (CID 68518607) is carbamic acid;[4-(2-hydroxyethyl)piperidin-1-yl]methylidenecarbamic acid.
What is the SMILES notation for carbamic acid;[4-(2-hydroxyethyl)piperidin-1-yl]methylidenecarbamic acid?
The canonical SMILES for carbamic acid;[4-(2-hydroxyethyl)piperidin-1-yl]methylidenecarbamic acid is NC(=O)O.O=C(O)N=CN1CCC(CCO)CC1.
What is the InChIKey of carbamic acid;[4-(2-hydroxyethyl)piperidin-1-yl]methylidenecarbamic acid?
The InChIKey is XRYAVFHJFLPYLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O3.CH3NO2/c12-6-3-8-1-4-11(5-2-8)7-10-9(13)14;2-1(3)4/h7-8,12H,1-6H2,(H,13,14);2H2,(H,3,4).
What are the key properties of carbamic acid;[4-(2-hydroxyethyl)piperidin-1-yl]methylidenecarbamic acid?
carbamic acid;[4-(2-hydroxyethyl)piperidin-1-yl]methylidenecarbamic acid has a molecular weight of 261.28 g/mol, XLogP of 0.41, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;[4-(2-hydroxyethyl)piperidin-1-yl]methylidenecarbamic acid is sourced from PubChem (CID 68518607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).