C10H19N3O5 — CID 68518607
carbamic acid;[4-(2-hydroxyethyl)piperidin-1-yl]methylidenecarbamic acid (PubChem CID 68518607) has the molecular formula C10H19N3O5 and a molecular weight of 261.28 g/mol. Its IUPAC name is carbamic acid;[4-(2-hydroxyethyl)piperidin-1-yl]methylidenecarbamic acid.
| Compound Name | carbamic acid;[4-(2-hydroxyethyl)piperidin-1-yl]methylidenecarbamic acid |
|---|---|
| PubChem CID | 68518607 |
| Molecular Formula | C10H19N3O5 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | carbamic acid;[4-(2-hydroxyethyl)piperidin-1-yl]methylidenecarbamic acid |
| SMILES | NC(=O)O.O=C(O)N=CN1CCC(CCO)CC1 |
| InChI | InChI=1S/C9H16N2O3.CH3NO2/c12-6-3-8-1-4-11(5-2-8)7-10-9(13)14;2-1(3)4/h7-8,12H,1-6H2,(H,13,14);2H2,(H,3,4) |
| InChIKey | XRYAVFHJFLPYLD-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 136.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|