C17H15N7O4 — CID 68518703
4-[7-amino-1-(4-nitrophenyl)pyrazolo[4,5-d]pyrimidin-3-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 68518703) has the molecular formula C17H15N7O4 and a molecular weight of 381.35 g/mol. Its IUPAC name is 4-[7-amino-1-(4-nitrophenyl)pyrazolo[4,5-d]pyrimidin-3-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid.
| Compound Name | 4-[7-amino-1-(4-nitrophenyl)pyrazolo[4,5-d]pyrimidin-3-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 68518703 |
| Molecular Formula | C17H15N7O4 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 4-[7-amino-1-(4-nitrophenyl)pyrazolo[4,5-d]pyrimidin-3-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| SMILES | Nc1ncnc2c(C3=CCN(C(=O)O)CC3)nn(-c3ccc([N+](=O)[O-])cc3)c12 |
| InChI | InChI=1S/C17H15N7O4/c18-16-15-14(19-9-20-16)13(10-5-7-22(8-6-10)17(25)26)21-23(15)11-1-3-12(4-2-11)24(27)28/h1-5,9H,6-8H2,(H,25,26)(H2,18,19,20) |
| InChIKey | XUQGUAGHLNFHBB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 153.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|