C27H36FN7O3 — CID 68518749
tert-butyl 4-[(1R)-1-[6-fluoro-5-[2-methyl-9-(oxan-2-yl)purin-6-yl]-3-pyridinyl]ethyl]piperazine-1-carboxylate (PubChem CID 68518749) has the molecular formula C27H36FN7O3 and a molecular weight of 525.63 g/mol. Its IUPAC name is tert-butyl 4-[(1R)-1-[6-fluoro-5-[2-methyl-9-(oxan-2-yl)purin-6-yl]-3-pyridinyl]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1R)-1-[6-fluoro-5-[2-methyl-9-(oxan-2-yl)purin-6-yl]-3-pyridinyl]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 68518749 |
| Molecular Formula | C27H36FN7O3 |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | tert-butyl 4-[(1R)-1-[6-fluoro-5-[2-methyl-9-(oxan-2-yl)purin-6-yl]-3-pyridinyl]ethyl]piperazine-1-carboxylate |
| SMILES | Cc1nc(-c2cc([C@@H](C)N3CCN(C(=O)OC(C)(C)C)CC3)cnc2F)c2ncn(C3CCCCO3)c2n1 |
| InChI | InChI=1S/C27H36FN7O3/c1-17(33-9-11-34(12-10-33)26(36)38-27(3,4)5)19-14-20(24(28)29-15-19)22-23-25(32-18(2)31-22)35(16-30-23)21-8-6-7-13-37-21/h14-17,21H,6-13H2,1-5H3/t17-,21?/m1/s1 |
| InChIKey | LTGFWORJFNTUOO-OQHSHRKDSA-N |
| XLogP | 4.65 |
| TPSA | 98.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|