C10H11ClF3NO3 — CID 68519971
2-(3-chloro-4-hydroxyphenyl)ethylazanium;2,2,2-trifluoroacetate (PubChem CID 68519971) has the molecular formula C10H11ClF3NO3 and a molecular weight of 285.65 g/mol. Its IUPAC name is 2-(3-chloro-4-hydroxyphenyl)ethylazanium;2,2,2-trifluoroacetate.
| Compound Name | 2-(3-chloro-4-hydroxyphenyl)ethylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68519971 |
| Molecular Formula | C10H11ClF3NO3 |
| Molecular Weight | 285.65 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 2-(3-chloro-4-hydroxyphenyl)ethylazanium;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.[NH3+]CCc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C8H10ClNO.C2HF3O2/c9-7-5-6(3-4-10)1-2-8(7)11;3-2(4,5)1(6)7/h1-2,5,11H,3-4,10H2;(H,6,7) |
| InChIKey | IZHVGRXNQFKFPM-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.65 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |