C26H34N4O5 — CID 68523841
[1-[1-[(3-ethoxy-4-pentan-3-yloxyphenyl)methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate (PubChem CID 68523841) has the molecular formula C26H34N4O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is [1-[1-[(3-ethoxy-4-pentan-3-yloxyphenyl)methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate.
| Compound Name | [1-[1-[(3-ethoxy-4-pentan-3-yloxyphenyl)methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 68523841 |
| Molecular Formula | C26H34N4O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | [1-[1-[(3-ethoxy-4-pentan-3-yloxyphenyl)methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate |
| SMILES | CCOc1cc(CN2CCC(n3nnc4cc(OC(=O)O)ccc43)CC2)ccc1OC(CC)CC |
| InChI | InChI=1S/C26H34N4O5/c1-4-20(5-2)34-24-10-7-18(15-25(24)33-6-3)17-29-13-11-19(12-14-29)30-23-9-8-21(35-26(31)32)16-22(23)27-28-30/h7-10,15-16,19-20H,4-6,11-14,17H2,1-3H3,(H,31,32) |
| InChIKey | KEIUCIQZTXWWJP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|