C27H26N6O6 — CID 68525603
5-[[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoethyl]-methylamino]-2-[(5-nitro-2-pyridinyl)oxy]benzonitrile (PubChem CID 68525603) has the molecular formula C27H26N6O6 and a molecular weight of 530.54 g/mol. Its IUPAC name is 5-[[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoethyl]-methylamino]-2-[(5-nitro-2-pyridinyl)oxy]benzonitrile.
| Compound Name | 5-[[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoethyl]-methylamino]-2-[(5-nitro-2-pyridinyl)oxy]benzonitrile |
|---|---|
| PubChem CID | 68525603 |
| Molecular Formula | C27H26N6O6 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 5-[[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoethyl]-methylamino]-2-[(5-nitro-2-pyridinyl)oxy]benzonitrile |
| SMILES | CN(CC(=O)N1CCN(Cc2ccc3c(c2)OCO3)CC1)c1ccc(Oc2ccc([N+](=O)[O-])cn2)c(C#N)c1 |
| InChI | InChI=1S/C27H26N6O6/c1-30(21-3-6-23(20(13-21)14-28)39-26-7-4-22(15-29-26)33(35)36)17-27(34)32-10-8-31(9-11-32)16-19-2-5-24-25(12-19)38-18-37-24/h2-7,12-13,15H,8-11,16-18H2,1H3 |
| InChIKey | INNBGWJABYFDNL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 134.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|