C27H25N5O6 — CID 86646550
1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-[4-[(5-nitro-2-pyridinyl)oxy]indol-1-yl]ethanone (PubChem CID 86646550) has the molecular formula C27H25N5O6 and a molecular weight of 515.53 g/mol. Its IUPAC name is 1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-[4-[(5-nitro-2-pyridinyl)oxy]indol-1-yl]ethanone.
| Compound Name | 1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-[4-[(5-nitro-2-pyridinyl)oxy]indol-1-yl]ethanone |
|---|---|
| PubChem CID | 86646550 |
| Molecular Formula | C27H25N5O6 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-[4-[(5-nitro-2-pyridinyl)oxy]indol-1-yl]ethanone |
| SMILES | O=C(Cn1ccc2c(Oc3ccc([N+](=O)[O-])cn3)cccc21)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C27H25N5O6/c33-27(30-12-10-29(11-13-30)16-19-4-6-24-25(14-19)37-18-36-24)17-31-9-8-21-22(31)2-1-3-23(21)38-26-7-5-20(15-28-26)32(34)35/h1-9,14-15H,10-13,16-18H2 |
| InChIKey | BHNQNLRXIUNEKI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 112.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|