C16H12N6O — CID 68526798
N-[5-(furan-2-yl)-1H-pyrazol-3-yl]-6-pyridin-2-ylpyrazin-2-amine (PubChem CID 68526798) has the molecular formula C16H12N6O and a molecular weight of 304.31 g/mol. Its IUPAC name is N-[5-(furan-2-yl)-1H-pyrazol-3-yl]-6-pyridin-2-ylpyrazin-2-amine.
| Compound Name | N-[5-(furan-2-yl)-1H-pyrazol-3-yl]-6-pyridin-2-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 68526798 |
| Molecular Formula | C16H12N6O |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | N-[5-(furan-2-yl)-1H-pyrazol-3-yl]-6-pyridin-2-ylpyrazin-2-amine |
| SMILES | c1ccc(-c2cncc(Nc3cc(-c4ccco4)[nH]n3)n2)nc1 |
| InChI | InChI=1S/C16H12N6O/c1-2-6-18-11(4-1)13-9-17-10-16(19-13)20-15-8-12(21-22-15)14-5-3-7-23-14/h1-10H,(H2,19,20,21,22) |
| InChIKey | GNSSAEQZQFUHPY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |