C18H19N3OS — CID 68528116
3-(3,4-dimethylphenyl)-1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]prop-2-yn-1-one (PubChem CID 68528116) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]prop-2-yn-1-one.
| Compound Name | 3-(3,4-dimethylphenyl)-1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 68528116 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]prop-2-yn-1-one |
| SMILES | Cc1ccc(C#CC(=O)N2CCN(c3nccs3)CC2)cc1C |
| InChI | InChI=1S/C18H19N3OS/c1-14-3-4-16(13-15(14)2)5-6-17(22)20-8-10-21(11-9-20)18-19-7-12-23-18/h3-4,7,12-13H,8-11H2,1-2H3 |
| InChIKey | NVDRPNMVKYOHQU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|