C21H23N3OSSi — CID 11516738
1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-[3-(2-trimethylsilylethynyl)phenyl]prop-2-yn-1-one (PubChem CID 11516738) has the molecular formula C21H23N3OSSi and a molecular weight of 393.59 g/mol. Its IUPAC name is 1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-[3-(2-trimethylsilylethynyl)phenyl]prop-2-yn-1-one.
| Compound Name | 1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-[3-(2-trimethylsilylethynyl)phenyl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 11516738 |
| Molecular Formula | C21H23N3OSSi |
| Molecular Weight | 393.59 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 1-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-3-[3-(2-trimethylsilylethynyl)phenyl]prop-2-yn-1-one |
| SMILES | C[Si](C)(C)C#Cc1cccc(C#CC(=O)N2CCN(c3nccs3)CC2)c1 |
| InChI | InChI=1S/C21H23N3OSSi/c1-27(2,3)16-9-19-6-4-5-18(17-19)7-8-20(25)23-11-13-24(14-12-23)21-22-10-15-26-21/h4-6,10,15,17H,11-14H2,1-3H3 |
| InChIKey | KEEKBXXCRZBKAD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.59 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|