C14H14FN3O2S — CID 62649639
3-fluoro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]benzoic acid (PubChem CID 62649639) has the molecular formula C14H14FN3O2S and a molecular weight of 307.35 g/mol. Its IUPAC name is 3-fluoro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]benzoic acid.
| Compound Name | 3-fluoro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 62649639 |
| Molecular Formula | C14H14FN3O2S |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 3-fluoro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(F)c1N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C14H14FN3O2S/c15-11-3-1-2-10(13(19)20)12(11)17-5-7-18(8-6-17)14-16-4-9-21-14/h1-4,9H,5-8H2,(H,19,20) |
| InChIKey | KZBQZUGRGGJYQT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |