C15H18N4S2 — CID 107107732
3-methyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]benzenecarbothioamide (PubChem CID 107107732) has the molecular formula C15H18N4S2 and a molecular weight of 318.47 g/mol. Its IUPAC name is 3-methyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]benzenecarbothioamide.
| Compound Name | 3-methyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]benzenecarbothioamide |
|---|---|
| PubChem CID | 107107732 |
| Molecular Formula | C15H18N4S2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 3-methyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]benzenecarbothioamide |
| SMILES | Cc1cccc(C(N)=S)c1N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C15H18N4S2/c1-11-3-2-4-12(14(16)20)13(11)18-6-8-19(9-7-18)15-17-5-10-21-15/h2-5,10H,6-9H2,1H3,(H2,16,20) |
| InChIKey | CKMGIVZQMSOQOJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|