C17H17N3OS — CID 68532452
1-[4-(5-methyl-1,3-thiazol-2-yl)piperazin-1-yl]-3-phenylprop-2-yn-1-one (PubChem CID 68532452) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 1-[4-(5-methyl-1,3-thiazol-2-yl)piperazin-1-yl]-3-phenylprop-2-yn-1-one.
| Compound Name | 1-[4-(5-methyl-1,3-thiazol-2-yl)piperazin-1-yl]-3-phenylprop-2-yn-1-one |
|---|---|
| PubChem CID | 68532452 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1-[4-(5-methyl-1,3-thiazol-2-yl)piperazin-1-yl]-3-phenylprop-2-yn-1-one |
| SMILES | Cc1cnc(N2CCN(C(=O)C#Cc3ccccc3)CC2)s1 |
| InChI | InChI=1S/C17H17N3OS/c1-14-13-18-17(22-14)20-11-9-19(10-12-20)16(21)8-7-15-5-3-2-4-6-15/h2-6,13H,9-12H2,1H3 |
| InChIKey | TXUFZXBICXCRJN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|