C19H19N3O3S — CID 68533900
ethyl 2-[4-(3-phenylprop-2-ynoyl)piperazin-1-yl]-1,3-thiazole-4-carboxylate (PubChem CID 68533900) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is ethyl 2-[4-(3-phenylprop-2-ynoyl)piperazin-1-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[4-(3-phenylprop-2-ynoyl)piperazin-1-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 68533900 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | ethyl 2-[4-(3-phenylprop-2-ynoyl)piperazin-1-yl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(N2CCN(C(=O)C#Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C19H19N3O3S/c1-2-25-18(24)16-14-26-19(20-16)22-12-10-21(11-13-22)17(23)9-8-15-6-4-3-5-7-15/h3-7,14H,2,10-13H2,1H3 |
| InChIKey | QLIURCKFGZVLKF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|