C25H32N2O4 — CID 68533265
1-(7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-3-[(5-methoxy-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)methylamino]propan-1-one (PubChem CID 68533265) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is 1-(7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-3-[(5-methoxy-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)methylamino]propan-1-one.
| Compound Name | 1-(7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-3-[(5-methoxy-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)methylamino]propan-1-one |
|---|---|
| PubChem CID | 68533265 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 1-(7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-3-[(5-methoxy-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)methylamino]propan-1-one |
| SMILES | COc1cc2c(cc1OC)CCN(C(=O)CCNCC1Cc3cccc(OC)c31)CC2 |
| InChI | InChI=1S/C25H32N2O4/c1-29-21-6-4-5-19-13-20(25(19)21)16-26-10-7-24(28)27-11-8-17-14-22(30-2)23(31-3)15-18(17)9-12-27/h4-6,14-15,20,26H,7-13,16H2,1-3H3 |
| InChIKey | NBQAPVMOJFWKHY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|