C28H38N2O4 — CID 68533469
1-(7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-3-[[3-[(2-methylpropan-2-yl)oxy]-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]methylamino]propan-1-one (PubChem CID 68533469) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is 1-(7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-3-[[3-[(2-methylpropan-2-yl)oxy]-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]methylamino]propan-1-one.
| Compound Name | 1-(7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-3-[[3-[(2-methylpropan-2-yl)oxy]-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]methylamino]propan-1-one |
|---|---|
| PubChem CID | 68533469 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 1-(7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-3-[[3-[(2-methylpropan-2-yl)oxy]-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]methylamino]propan-1-one |
| SMILES | COc1cc2c(cc1OC)CCN(C(=O)CCNCC1Cc3cc(OC(C)(C)C)ccc31)CC2 |
| InChI | InChI=1S/C28H38N2O4/c1-28(2,3)34-23-6-7-24-21(15-23)14-22(24)18-29-11-8-27(31)30-12-9-19-16-25(32-4)26(33-5)17-20(19)10-13-30/h6-7,15-17,22,29H,8-14,18H2,1-5H3 |
| InChIKey | BPRORBWQIZMXCB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|