C32H42N2O8 — CID 68974981
[7-[[[3-(7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-3-oxopropyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl] ethyl carbonate (PubChem CID 68974981) has the molecular formula C32H42N2O8 and a molecular weight of 582.69 g/mol. Its IUPAC name is [7-[[[3-(7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-3-oxopropyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl] ethyl carbonate.
| Compound Name | [7-[[[3-(7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-3-oxopropyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl] ethyl carbonate |
|---|---|
| PubChem CID | 68974981 |
| Molecular Formula | C32H42N2O8 |
| Molecular Weight | 582.69 g/mol |
| Exact Mass | 582.29 |
| IUPAC Name | [7-[[[3-(7,8-dimethoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-3-oxopropyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc2c(c1)CC2CN(CCC(=O)N1CCc2cc(OC)c(OC)cc2CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H42N2O8/c1-7-40-31(37)41-25-8-9-26-23(17-25)16-24(26)20-34(30(36)42-32(2,3)4)15-12-29(35)33-13-10-21-18-27(38-5)28(39-6)19-22(21)11-14-33/h8-9,17-19,24H,7,10-16,20H2,1-6H3 |
| InChIKey | LADMAFRBKTUBIW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 103.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.69 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|