C27H32N4O2 — CID 68533305
1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-(4-piperidin-1-ylphenyl)urea (PubChem CID 68533305) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-(4-piperidin-1-ylphenyl)urea.
| Compound Name | 1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-(4-piperidin-1-ylphenyl)urea |
|---|---|
| PubChem CID | 68533305 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-(4-piperidin-1-ylphenyl)urea |
| SMILES | CC(C)(C)c1ccccc1Oc1ncccc1NC(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C27H32N4O2/c1-27(2,3)22-10-5-6-12-24(22)33-25-23(11-9-17-28-25)30-26(32)29-20-13-15-21(16-14-20)31-18-7-4-8-19-31/h5-6,9-17H,4,7-8,18-19H2,1-3H3,(H2,29,30,32) |
| InChIKey | ICIKLYFRSARBSE-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|