C19H20FN7O3S — CID 68533950
2-(5-amino-2-fluoroanilino)-4-[2-(methylsulfonylmethylamino)anilino]pyrimidine-5-carboxamide (PubChem CID 68533950) has the molecular formula C19H20FN7O3S and a molecular weight of 445.48 g/mol. Its IUPAC name is 2-(5-amino-2-fluoroanilino)-4-[2-(methylsulfonylmethylamino)anilino]pyrimidine-5-carboxamide.
| Compound Name | 2-(5-amino-2-fluoroanilino)-4-[2-(methylsulfonylmethylamino)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 68533950 |
| Molecular Formula | C19H20FN7O3S |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 2-(5-amino-2-fluoroanilino)-4-[2-(methylsulfonylmethylamino)anilino]pyrimidine-5-carboxamide |
| SMILES | CS(=O)(=O)CNc1ccccc1Nc1nc(Nc2cc(N)ccc2F)ncc1C(N)=O |
| InChI | InChI=1S/C19H20FN7O3S/c1-31(29,30)10-24-14-4-2-3-5-15(14)25-18-12(17(22)28)9-23-19(27-18)26-16-8-11(21)6-7-13(16)20/h2-9,24H,10,21H2,1H3,(H2,22,28)(H2,23,25,26,27) |
| InChIKey | NUNVDYXUCQDRFA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 165.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|