C23H19FN6O3S — CID 59145747
2-(2-fluoro-5-phenylanilino)-4-(2-sulfamoylanilino)pyrimidine-5-carboxamide (PubChem CID 59145747) has the molecular formula C23H19FN6O3S and a molecular weight of 478.51 g/mol. Its IUPAC name is 2-(2-fluoro-5-phenylanilino)-4-(2-sulfamoylanilino)pyrimidine-5-carboxamide.
| Compound Name | 2-(2-fluoro-5-phenylanilino)-4-(2-sulfamoylanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 59145747 |
| Molecular Formula | C23H19FN6O3S |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 2-(2-fluoro-5-phenylanilino)-4-(2-sulfamoylanilino)pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cnc(Nc2cc(-c3ccccc3)ccc2F)nc1Nc1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C23H19FN6O3S/c24-17-11-10-15(14-6-2-1-3-7-14)12-19(17)29-23-27-13-16(21(25)31)22(30-23)28-18-8-4-5-9-20(18)34(26,32)33/h1-13H,(H2,25,31)(H2,26,32,33)(H2,27,28,29,30) |
| InChIKey | ONJJDQSCMPTLPB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 153.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |