C18H23N3O3 — CID 68535416
1-methyl-7-[(4-propanoylpiperazin-1-yl)methyl]indole-2-carboxylic acid (PubChem CID 68535416) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-methyl-7-[(4-propanoylpiperazin-1-yl)methyl]indole-2-carboxylic acid.
| Compound Name | 1-methyl-7-[(4-propanoylpiperazin-1-yl)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 68535416 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-methyl-7-[(4-propanoylpiperazin-1-yl)methyl]indole-2-carboxylic acid |
| SMILES | CCC(=O)N1CCN(Cc2cccc3cc(C(=O)O)n(C)c23)CC1 |
| InChI | InChI=1S/C18H23N3O3/c1-3-16(22)21-9-7-20(8-10-21)12-14-6-4-5-13-11-15(18(23)24)19(2)17(13)14/h4-6,11H,3,7-10,12H2,1-2H3,(H,23,24) |
| InChIKey | GQLRHOVGGRWNKN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |