C24H34ClNO4 — CID 68538993
(4R,4aS,7aR,12bS)-9-hydroxy-4a-(3-methylbutoxy)-3-propyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one;hydrochloride (PubChem CID 68538993) has the molecular formula C24H34ClNO4 and a molecular weight of 435.99 g/mol. Its IUPAC name is (4R,4aS,7aR,12bS)-9-hydroxy-4a-(3-methylbutoxy)-3-propyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one;hydrochloride.
| Compound Name | (4R,4aS,7aR,12bS)-9-hydroxy-4a-(3-methylbutoxy)-3-propyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one;hydrochloride |
|---|---|
| PubChem CID | 68538993 |
| Molecular Formula | C24H34ClNO4 |
| Molecular Weight | 435.99 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | (4R,4aS,7aR,12bS)-9-hydroxy-4a-(3-methylbutoxy)-3-propyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one;hydrochloride |
| SMILES | CCCN1CC[C@]23c4c5ccc(O)c4O[C@H]2C(=O)CC[C@@]3(OCCC(C)C)[C@H]1C5.Cl |
| InChI | InChI=1S/C24H33NO4.ClH/c1-4-11-25-12-10-23-20-16-5-6-17(26)21(20)29-22(23)18(27)7-9-24(23,19(25)14-16)28-13-8-15(2)3;/h5-6,15,19,22,26H,4,7-14H2,1-3H3;1H/t19-,22+,23+,24-;/m1./s1 |
| InChIKey | ZESAZYSJWQUXHO-QAZQOLFRSA-N |
| XLogP | 4.02 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.99 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |