C24H26F2N2O5 — CID 68541077
3-[[(2R,3S)-3-acetamido-4-(3,5-difluorophenyl)-2-hydroxybutyl]amino]-3-[3-(3-hydroxyprop-1-ynyl)phenyl]propanoic acid (PubChem CID 68541077) has the molecular formula C24H26F2N2O5 and a molecular weight of 460.48 g/mol. Its IUPAC name is 3-[[(2R,3S)-3-acetamido-4-(3,5-difluorophenyl)-2-hydroxybutyl]amino]-3-[3-(3-hydroxyprop-1-ynyl)phenyl]propanoic acid.
| Compound Name | 3-[[(2R,3S)-3-acetamido-4-(3,5-difluorophenyl)-2-hydroxybutyl]amino]-3-[3-(3-hydroxyprop-1-ynyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 68541077 |
| Molecular Formula | C24H26F2N2O5 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 3-[[(2R,3S)-3-acetamido-4-(3,5-difluorophenyl)-2-hydroxybutyl]amino]-3-[3-(3-hydroxyprop-1-ynyl)phenyl]propanoic acid |
| SMILES | CC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@H](O)CNC(CC(=O)O)c1cccc(C#CCO)c1 |
| InChI | InChI=1S/C24H26F2N2O5/c1-15(30)28-22(11-17-9-19(25)12-20(26)10-17)23(31)14-27-21(13-24(32)33)18-6-2-4-16(8-18)5-3-7-29/h2,4,6,8-10,12,21-23,27,29,31H,7,11,13-14H2,1H3,(H,28,30)(H,32,33)/t21?,22-,23+/m0/s1 |
| InChIKey | LSYXJPVGHWUXPP-ATTQYFOMSA-N |
| XLogP | 1.52 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|